C22H25BrClN3O3S — CID 4959970
3-bromo-N-[[[2-(4-chlorophenyl)acetyl]amino]carbamothioyl]-4-hexoxybenzamide (PubChem CID 4959970) has the molecular formula C22H25BrClN3O3S and a molecular weight of 526.88 g/mol. Its IUPAC name is 3-bromo-N-[[[2-(4-chlorophenyl)acetyl]amino]carbamothioyl]-4-hexoxybenzamide.
| Compound Name | 3-bromo-N-[[[2-(4-chlorophenyl)acetyl]amino]carbamothioyl]-4-hexoxybenzamide |
|---|---|
| PubChem CID | 4959970 |
| Molecular Formula | C22H25BrClN3O3S |
| Molecular Weight | 526.88 g/mol |
| Exact Mass | 525.05 |
| IUPAC Name | 3-bromo-N-[[[2-(4-chlorophenyl)acetyl]amino]carbamothioyl]-4-hexoxybenzamide |
| SMILES | CCCCCCOc1ccc(C(=O)NC(=S)NNC(=O)Cc2ccc(Cl)cc2)cc1Br |
| InChI | InChI=1S/C22H25BrClN3O3S/c1-2-3-4-5-12-30-19-11-8-16(14-18(19)23)21(29)25-22(31)27-26-20(28)13-15-6-9-17(24)10-7-15/h6-11,14H,2-5,12-13H2,1H3,(H,26,28)(H2,25,27,29,31) |
| InChIKey | OPURDFKCDHUMJC-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.88 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|