C28H30BrN3O4S — CID 4959891
3-bromo-4-hexoxy-N-[[[2-(2-phenylphenoxy)acetyl]amino]carbamothioyl]benzamide (PubChem CID 4959891) has the molecular formula C28H30BrN3O4S and a molecular weight of 584.54 g/mol. Its IUPAC name is 3-bromo-4-hexoxy-N-[[[2-(2-phenylphenoxy)acetyl]amino]carbamothioyl]benzamide.
| Compound Name | 3-bromo-4-hexoxy-N-[[[2-(2-phenylphenoxy)acetyl]amino]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 4959891 |
| Molecular Formula | C28H30BrN3O4S |
| Molecular Weight | 584.54 g/mol |
| Exact Mass | 583.11 |
| IUPAC Name | 3-bromo-4-hexoxy-N-[[[2-(2-phenylphenoxy)acetyl]amino]carbamothioyl]benzamide |
| SMILES | CCCCCCOc1ccc(C(=O)NC(=S)NNC(=O)COc2ccccc2-c2ccccc2)cc1Br |
| InChI | InChI=1S/C28H30BrN3O4S/c1-2-3-4-10-17-35-25-16-15-21(18-23(25)29)27(34)30-28(37)32-31-26(33)19-36-24-14-9-8-13-22(24)20-11-6-5-7-12-20/h5-9,11-16,18H,2-4,10,17,19H2,1H3,(H,31,33)(H2,30,32,34,37) |
| InChIKey | SSZSPJPLTBQBHZ-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.54 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|