C24H29Cl2N3O4S — CID 4934626
N-[[4-(2,4-dichlorophenoxy)butanoylamino]carbamothioyl]-4-hexoxybenzamide (PubChem CID 4934626) has the molecular formula C24H29Cl2N3O4S and a molecular weight of 526.49 g/mol. Its IUPAC name is N-[[4-(2,4-dichlorophenoxy)butanoylamino]carbamothioyl]-4-hexoxybenzamide.
| Compound Name | N-[[4-(2,4-dichlorophenoxy)butanoylamino]carbamothioyl]-4-hexoxybenzamide |
|---|---|
| PubChem CID | 4934626 |
| Molecular Formula | C24H29Cl2N3O4S |
| Molecular Weight | 526.49 g/mol |
| Exact Mass | 525.13 |
| IUPAC Name | N-[[4-(2,4-dichlorophenoxy)butanoylamino]carbamothioyl]-4-hexoxybenzamide |
| SMILES | CCCCCCOc1ccc(C(=O)NC(=S)NNC(=O)CCCOc2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C24H29Cl2N3O4S/c1-2-3-4-5-14-32-19-11-8-17(9-12-19)23(31)27-24(34)29-28-22(30)7-6-15-33-21-13-10-18(25)16-20(21)26/h8-13,16H,2-7,14-15H2,1H3,(H,28,30)(H2,27,29,31,34) |
| InChIKey | XSSMUTWQXUXNRM-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.49 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|