C22H25Cl2N3O4S — CID 4941766
2-butoxy-N-[[4-(2,4-dichlorophenoxy)butanoylamino]carbamothioyl]benzamide (PubChem CID 4941766) has the molecular formula C22H25Cl2N3O4S and a molecular weight of 498.43 g/mol. Its IUPAC name is 2-butoxy-N-[[4-(2,4-dichlorophenoxy)butanoylamino]carbamothioyl]benzamide.
| Compound Name | 2-butoxy-N-[[4-(2,4-dichlorophenoxy)butanoylamino]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 4941766 |
| Molecular Formula | C22H25Cl2N3O4S |
| Molecular Weight | 498.43 g/mol |
| Exact Mass | 497.09 |
| IUPAC Name | 2-butoxy-N-[[4-(2,4-dichlorophenoxy)butanoylamino]carbamothioyl]benzamide |
| SMILES | CCCCOc1ccccc1C(=O)NC(=S)NNC(=O)CCCOc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C22H25Cl2N3O4S/c1-2-3-12-30-18-8-5-4-7-16(18)21(29)25-22(32)27-26-20(28)9-6-13-31-19-11-10-15(23)14-17(19)24/h4-5,7-8,10-11,14H,2-3,6,9,12-13H2,1H3,(H,26,28)(H2,25,27,29,32) |
| InChIKey | YOYBDVKISBWXOJ-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.43 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|