C20H22Cl2N2O5 — CID 17355597
N'-[4-(2,4-dichlorophenoxy)butanoyl]-2-(2-methoxyethoxy)benzohydrazide (PubChem CID 17355597) has the molecular formula C20H22Cl2N2O5 and a molecular weight of 441.31 g/mol. Its IUPAC name is N'-[4-(2,4-dichlorophenoxy)butanoyl]-2-(2-methoxyethoxy)benzohydrazide.
| Compound Name | N'-[4-(2,4-dichlorophenoxy)butanoyl]-2-(2-methoxyethoxy)benzohydrazide |
|---|---|
| PubChem CID | 17355597 |
| Molecular Formula | C20H22Cl2N2O5 |
| Molecular Weight | 441.31 g/mol |
| Exact Mass | 440.09 |
| IUPAC Name | N'-[4-(2,4-dichlorophenoxy)butanoyl]-2-(2-methoxyethoxy)benzohydrazide |
| SMILES | COCCOc1ccccc1C(=O)NNC(=O)CCCOc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C20H22Cl2N2O5/c1-27-11-12-29-17-6-3-2-5-15(17)20(26)24-23-19(25)7-4-10-28-18-9-8-14(21)13-16(18)22/h2-3,5-6,8-9,13H,4,7,10-12H2,1H3,(H,23,25)(H,24,26) |
| InChIKey | XXNXBIQDGRITAH-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.31 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|