C17H15Cl2F2N3O3S — CID 24538204
N'-[4-(2,4-dichlorophenoxy)butanoyl]-2-(difluoromethylsulfanyl)pyridine-3-carbohydrazide (PubChem CID 24538204) has the molecular formula C17H15Cl2F2N3O3S and a molecular weight of 450.29 g/mol. Its IUPAC name is N'-[4-(2,4-dichlorophenoxy)butanoyl]-2-(difluoromethylsulfanyl)pyridine-3-carbohydrazide.
| Compound Name | N'-[4-(2,4-dichlorophenoxy)butanoyl]-2-(difluoromethylsulfanyl)pyridine-3-carbohydrazide |
|---|---|
| PubChem CID | 24538204 |
| Molecular Formula | C17H15Cl2F2N3O3S |
| Molecular Weight | 450.29 g/mol |
| Exact Mass | 449.02 |
| IUPAC Name | N'-[4-(2,4-dichlorophenoxy)butanoyl]-2-(difluoromethylsulfanyl)pyridine-3-carbohydrazide |
| SMILES | O=C(CCCOc1ccc(Cl)cc1Cl)NNC(=O)c1cccnc1SC(F)F |
| InChI | InChI=1S/C17H15Cl2F2N3O3S/c18-10-5-6-13(12(19)9-10)27-8-2-4-14(25)23-24-15(26)11-3-1-7-22-16(11)28-17(20)21/h1,3,5-7,9,17H,2,4,8H2,(H,23,25)(H,24,26) |
| InChIKey | VINUTFMZZIEMRJ-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.29 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|