C19H19Cl2FN2O3 — CID 60551379
N-[2-[4-(2,4-dichlorophenoxy)butanoylamino]ethyl]-2-fluorobenzamide (PubChem CID 60551379) has the molecular formula C19H19Cl2FN2O3 and a molecular weight of 413.28 g/mol. Its IUPAC name is N-[2-[4-(2,4-dichlorophenoxy)butanoylamino]ethyl]-2-fluorobenzamide.
| Compound Name | N-[2-[4-(2,4-dichlorophenoxy)butanoylamino]ethyl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 60551379 |
| Molecular Formula | C19H19Cl2FN2O3 |
| Molecular Weight | 413.28 g/mol |
| Exact Mass | 412.08 |
| IUPAC Name | N-[2-[4-(2,4-dichlorophenoxy)butanoylamino]ethyl]-2-fluorobenzamide |
| SMILES | O=C(CCCOc1ccc(Cl)cc1Cl)NCCNC(=O)c1ccccc1F |
| InChI | InChI=1S/C19H19Cl2FN2O3/c20-13-7-8-17(15(21)12-13)27-11-3-6-18(25)23-9-10-24-19(26)14-4-1-2-5-16(14)22/h1-2,4-5,7-8,12H,3,6,9-11H2,(H,23,25)(H,24,26) |
| InChIKey | WFBKLLQLLSAUIW-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.28 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|