C14H19Cl2NO4S — CID 60550353
4-(2,4-dichlorophenoxy)-N-(3-methylsulfonylpropyl)butanamide (PubChem CID 60550353) has the molecular formula C14H19Cl2NO4S and a molecular weight of 368.28 g/mol. Its IUPAC name is 4-(2,4-dichlorophenoxy)-N-(3-methylsulfonylpropyl)butanamide.
| Compound Name | 4-(2,4-dichlorophenoxy)-N-(3-methylsulfonylpropyl)butanamide |
|---|---|
| PubChem CID | 60550353 |
| Molecular Formula | C14H19Cl2NO4S |
| Molecular Weight | 368.28 g/mol |
| Exact Mass | 367.04 |
| IUPAC Name | 4-(2,4-dichlorophenoxy)-N-(3-methylsulfonylpropyl)butanamide |
| SMILES | CS(=O)(=O)CCCNC(=O)CCCOc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C14H19Cl2NO4S/c1-22(19,20)9-3-7-17-14(18)4-2-8-21-13-6-5-11(15)10-12(13)16/h5-6,10H,2-4,7-9H2,1H3,(H,17,18) |
| InChIKey | HCFSEGCUGLSOGL-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.28 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|