C13H15Cl2NO4S — CID 147530715
2-(2,4-dichlorophenoxy)-N-(3-ethenylsulfonylpropyl)acetamide (PubChem CID 147530715) has the molecular formula C13H15Cl2NO4S and a molecular weight of 352.24 g/mol. Its IUPAC name is 2-(2,4-dichlorophenoxy)-N-(3-ethenylsulfonylpropyl)acetamide.
| Compound Name | 2-(2,4-dichlorophenoxy)-N-(3-ethenylsulfonylpropyl)acetamide |
|---|---|
| PubChem CID | 147530715 |
| Molecular Formula | C13H15Cl2NO4S |
| Molecular Weight | 352.24 g/mol |
| Exact Mass | 351.01 |
| IUPAC Name | 2-(2,4-dichlorophenoxy)-N-(3-ethenylsulfonylpropyl)acetamide |
| SMILES | C=CS(=O)(=O)CCCNC(=O)COc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C13H15Cl2NO4S/c1-2-21(18,19)7-3-6-16-13(17)9-20-12-5-4-10(14)8-11(12)15/h2,4-5,8H,1,3,6-7,9H2,(H,16,17) |
| InChIKey | FMZCHTKTRAPPKC-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.24 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|