C15H23Cl2N3O2 — CID 14751497
N-[4-(3-aminopropylamino)butyl]-2-(2,4-dichlorophenoxy)acetamide (PubChem CID 14751497) has the molecular formula C15H23Cl2N3O2 and a molecular weight of 348.27 g/mol. Its IUPAC name is N-[4-(3-aminopropylamino)butyl]-2-(2,4-dichlorophenoxy)acetamide.
| Compound Name | N-[4-(3-aminopropylamino)butyl]-2-(2,4-dichlorophenoxy)acetamide |
|---|---|
| PubChem CID | 14751497 |
| Molecular Formula | C15H23Cl2N3O2 |
| Molecular Weight | 348.27 g/mol |
| Exact Mass | 347.12 |
| IUPAC Name | N-[4-(3-aminopropylamino)butyl]-2-(2,4-dichlorophenoxy)acetamide |
| SMILES | NCCCNCCCCNC(=O)COc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C15H23Cl2N3O2/c16-12-4-5-14(13(17)10-12)22-11-15(21)20-9-2-1-7-19-8-3-6-18/h4-5,10,19H,1-3,6-9,11,18H2,(H,20,21) |
| InChIKey | AYAMZQQTFCIEAT-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.27 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|