C13H15Cl2NO4 — CID 47437686
ethyl 3-[[2-(2,4-dichlorophenoxy)acetyl]amino]propanoate (PubChem CID 47437686) has the molecular formula C13H15Cl2NO4 and a molecular weight of 320.17 g/mol. Its IUPAC name is ethyl 3-[[2-(2,4-dichlorophenoxy)acetyl]amino]propanoate.
| Compound Name | ethyl 3-[[2-(2,4-dichlorophenoxy)acetyl]amino]propanoate |
|---|---|
| PubChem CID | 47437686 |
| Molecular Formula | C13H15Cl2NO4 |
| Molecular Weight | 320.17 g/mol |
| Exact Mass | 319.04 |
| IUPAC Name | ethyl 3-[[2-(2,4-dichlorophenoxy)acetyl]amino]propanoate |
| SMILES | CCOC(=O)CCNC(=O)COc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C13H15Cl2NO4/c1-2-19-13(18)5-6-16-12(17)8-20-11-4-3-9(14)7-10(11)15/h3-4,7H,2,5-6,8H2,1H3,(H,16,17) |
| InChIKey | ONIXSMQUGBLHAW-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.17 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |