C19H19Cl3N2O3 — CID 108541625
3-(4-chlorophenyl)-N-[2-[[2-(2,4-dichlorophenoxy)acetyl]amino]ethyl]propanamide (PubChem CID 108541625) has the molecular formula C19H19Cl3N2O3 and a molecular weight of 429.73 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-N-[2-[[2-(2,4-dichlorophenoxy)acetyl]amino]ethyl]propanamide.
| Compound Name | 3-(4-chlorophenyl)-N-[2-[[2-(2,4-dichlorophenoxy)acetyl]amino]ethyl]propanamide |
|---|---|
| PubChem CID | 108541625 |
| Molecular Formula | C19H19Cl3N2O3 |
| Molecular Weight | 429.73 g/mol |
| Exact Mass | 428.05 |
| IUPAC Name | 3-(4-chlorophenyl)-N-[2-[[2-(2,4-dichlorophenoxy)acetyl]amino]ethyl]propanamide |
| SMILES | O=C(CCc1ccc(Cl)cc1)NCCNC(=O)COc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C19H19Cl3N2O3/c20-14-4-1-13(2-5-14)3-8-18(25)23-9-10-24-19(26)12-27-17-7-6-15(21)11-16(17)22/h1-2,4-7,11H,3,8-10,12H2,(H,23,25)(H,24,26) |
| InChIKey | ZZUVSNSYWZKPPB-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.73 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|