C15H21Cl2N3O3 — CID 108572858
2-(2,4-dichlorophenoxy)-N-[2-(diethylcarbamoylamino)ethyl]acetamide (PubChem CID 108572858) has the molecular formula C15H21Cl2N3O3 and a molecular weight of 362.26 g/mol. Its IUPAC name is 2-(2,4-dichlorophenoxy)-N-[2-(diethylcarbamoylamino)ethyl]acetamide.
| Compound Name | 2-(2,4-dichlorophenoxy)-N-[2-(diethylcarbamoylamino)ethyl]acetamide |
|---|---|
| PubChem CID | 108572858 |
| Molecular Formula | C15H21Cl2N3O3 |
| Molecular Weight | 362.26 g/mol |
| Exact Mass | 361.10 |
| IUPAC Name | 2-(2,4-dichlorophenoxy)-N-[2-(diethylcarbamoylamino)ethyl]acetamide |
| SMILES | CCN(CC)C(=O)NCCNC(=O)COc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C15H21Cl2N3O3/c1-3-20(4-2)15(22)19-8-7-18-14(21)10-23-13-6-5-11(16)9-12(13)17/h5-6,9H,3-4,7-8,10H2,1-2H3,(H,18,21)(H,19,22) |
| InChIKey | GATNVWRWZZHRHT-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.26 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|