C16H22Cl2N2O3 — CID 113052412
N-[2-[acetyl(butyl)amino]ethyl]-2-(2,4-dichlorophenoxy)acetamide (PubChem CID 113052412) has the molecular formula C16H22Cl2N2O3 and a molecular weight of 361.27 g/mol. Its IUPAC name is N-[2-[acetyl(butyl)amino]ethyl]-2-(2,4-dichlorophenoxy)acetamide.
| Compound Name | N-[2-[acetyl(butyl)amino]ethyl]-2-(2,4-dichlorophenoxy)acetamide |
|---|---|
| PubChem CID | 113052412 |
| Molecular Formula | C16H22Cl2N2O3 |
| Molecular Weight | 361.27 g/mol |
| Exact Mass | 360.10 |
| IUPAC Name | N-[2-[acetyl(butyl)amino]ethyl]-2-(2,4-dichlorophenoxy)acetamide |
| SMILES | CCCCN(CCNC(=O)COc1ccc(Cl)cc1Cl)C(C)=O |
| InChI | InChI=1S/C16H22Cl2N2O3/c1-3-4-8-20(12(2)21)9-7-19-16(22)11-23-15-6-5-13(17)10-14(15)18/h5-6,10H,3-4,7-9,11H2,1-2H3,(H,19,22) |
| InChIKey | VQDAUPXJGOJNNS-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.27 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |