C12H13BrClNO4 — CID 17401669
methyl 3-[[2-(2-bromo-4-chlorophenoxy)acetyl]amino]propanoate (PubChem CID 17401669) has the molecular formula C12H13BrClNO4 and a molecular weight of 350.60 g/mol. Its IUPAC name is methyl 3-[[2-(2-bromo-4-chlorophenoxy)acetyl]amino]propanoate.
| Compound Name | methyl 3-[[2-(2-bromo-4-chlorophenoxy)acetyl]amino]propanoate |
|---|---|
| PubChem CID | 17401669 |
| Molecular Formula | C12H13BrClNO4 |
| Molecular Weight | 350.60 g/mol |
| Exact Mass | 348.97 |
| IUPAC Name | methyl 3-[[2-(2-bromo-4-chlorophenoxy)acetyl]amino]propanoate |
| SMILES | COC(=O)CCNC(=O)COc1ccc(Cl)cc1Br |
| InChI | InChI=1S/C12H13BrClNO4/c1-18-12(17)4-5-15-11(16)7-19-10-3-2-8(14)6-9(10)13/h2-3,6H,4-5,7H2,1H3,(H,15,16) |
| InChIKey | ZLMGLOCCIFORSN-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.60 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |