C17H22ClNO6 — CID 29155553
ethyl 4-[[2-[2-(4-chloro-2-methylphenoxy)acetyl]oxyacetyl]amino]butanoate (PubChem CID 29155553) has the molecular formula C17H22ClNO6 and a molecular weight of 371.82 g/mol. Its IUPAC name is ethyl 4-[[2-[2-(4-chloro-2-methylphenoxy)acetyl]oxyacetyl]amino]butanoate.
| Compound Name | ethyl 4-[[2-[2-(4-chloro-2-methylphenoxy)acetyl]oxyacetyl]amino]butanoate |
|---|---|
| PubChem CID | 29155553 |
| Molecular Formula | C17H22ClNO6 |
| Molecular Weight | 371.82 g/mol |
| Exact Mass | 371.11 |
| IUPAC Name | ethyl 4-[[2-[2-(4-chloro-2-methylphenoxy)acetyl]oxyacetyl]amino]butanoate |
| SMILES | CCOC(=O)CCCNC(=O)COC(=O)COc1ccc(Cl)cc1C |
| InChI | InChI=1S/C17H22ClNO6/c1-3-23-16(21)5-4-8-19-15(20)10-25-17(22)11-24-14-7-6-13(18)9-12(14)2/h6-7,9H,3-5,8,10-11H2,1-2H3,(H,19,20) |
| InChIKey | DRBOXXPHALWPLW-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.82 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|