C11H11Cl2NO4 — CID 2628002
ethyl N-[2-(2,4-dichlorophenoxy)acetyl]carbamate (PubChem CID 2628002) has the molecular formula C11H11Cl2NO4 and a molecular weight of 292.12 g/mol. Its IUPAC name is ethyl N-[2-(2,4-dichlorophenoxy)acetyl]carbamate.
| Compound Name | ethyl N-[2-(2,4-dichlorophenoxy)acetyl]carbamate |
|---|---|
| PubChem CID | 2628002 |
| Molecular Formula | C11H11Cl2NO4 |
| Molecular Weight | 292.12 g/mol |
| Exact Mass | 291.01 |
| IUPAC Name | ethyl N-[2-(2,4-dichlorophenoxy)acetyl]carbamate |
| SMILES | CCOC(=O)NC(=O)COc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C11H11Cl2NO4/c1-2-17-11(16)14-10(15)6-18-9-4-3-7(12)5-8(9)13/h3-5H,2,6H2,1H3,(H,14,15,16) |
| InChIKey | JAAUAGOZQZZLKV-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.12 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |