C11H12Cl2N2O4 — CID 27396145
2-(2,4-dichlorophenoxy)-N-(2-hydroxyethylcarbamoyl)acetamide (PubChem CID 27396145) has the molecular formula C11H12Cl2N2O4 and a molecular weight of 307.13 g/mol. Its IUPAC name is 2-(2,4-dichlorophenoxy)-N-(2-hydroxyethylcarbamoyl)acetamide.
| Compound Name | 2-(2,4-dichlorophenoxy)-N-(2-hydroxyethylcarbamoyl)acetamide |
|---|---|
| PubChem CID | 27396145 |
| Molecular Formula | C11H12Cl2N2O4 |
| Molecular Weight | 307.13 g/mol |
| Exact Mass | 306.02 |
| IUPAC Name | 2-(2,4-dichlorophenoxy)-N-(2-hydroxyethylcarbamoyl)acetamide |
| SMILES | O=C(COc1ccc(Cl)cc1Cl)NC(=O)NCCO |
| InChI | InChI=1S/C11H12Cl2N2O4/c12-7-1-2-9(8(13)5-7)19-6-10(17)15-11(18)14-3-4-16/h1-2,5,16H,3-4,6H2,(H2,14,15,17,18) |
| InChIKey | PUXHFZNTKSRTLR-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.13 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |