C17H16Cl2N2O4 — CID 24811987
3-[[2-(2,4-dichlorophenoxy)acetyl]amino]-N-(2-hydroxyethyl)benzamide (PubChem CID 24811987) has the molecular formula C17H16Cl2N2O4 and a molecular weight of 383.23 g/mol. Its IUPAC name is 3-[[2-(2,4-dichlorophenoxy)acetyl]amino]-N-(2-hydroxyethyl)benzamide.
| Compound Name | 3-[[2-(2,4-dichlorophenoxy)acetyl]amino]-N-(2-hydroxyethyl)benzamide |
|---|---|
| PubChem CID | 24811987 |
| Molecular Formula | C17H16Cl2N2O4 |
| Molecular Weight | 383.23 g/mol |
| Exact Mass | 382.05 |
| IUPAC Name | 3-[[2-(2,4-dichlorophenoxy)acetyl]amino]-N-(2-hydroxyethyl)benzamide |
| SMILES | O=C(COc1ccc(Cl)cc1Cl)Nc1cccc(C(=O)NCCO)c1 |
| InChI | InChI=1S/C17H16Cl2N2O4/c18-12-4-5-15(14(19)9-12)25-10-16(23)21-13-3-1-2-11(8-13)17(24)20-6-7-22/h1-5,8-9,22H,6-7,10H2,(H,20,24)(H,21,23) |
| InChIKey | DYQAIAHIISXKQF-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.23 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |