C17H15BrCl2N2O3 — CID 108539659
3-bromo-N-[2-[[2-(2,4-dichlorophenoxy)acetyl]amino]ethyl]benzamide (PubChem CID 108539659) has the molecular formula C17H15BrCl2N2O3 and a molecular weight of 446.13 g/mol. Its IUPAC name is 3-bromo-N-[2-[[2-(2,4-dichlorophenoxy)acetyl]amino]ethyl]benzamide.
| Compound Name | 3-bromo-N-[2-[[2-(2,4-dichlorophenoxy)acetyl]amino]ethyl]benzamide |
|---|---|
| PubChem CID | 108539659 |
| Molecular Formula | C17H15BrCl2N2O3 |
| Molecular Weight | 446.13 g/mol |
| Exact Mass | 443.96 |
| IUPAC Name | 3-bromo-N-[2-[[2-(2,4-dichlorophenoxy)acetyl]amino]ethyl]benzamide |
| SMILES | O=C(COc1ccc(Cl)cc1Cl)NCCNC(=O)c1cccc(Br)c1 |
| InChI | InChI=1S/C17H15BrCl2N2O3/c18-12-3-1-2-11(8-12)17(24)22-7-6-21-16(23)10-25-15-5-4-13(19)9-14(15)20/h1-5,8-9H,6-7,10H2,(H,21,23)(H,22,24) |
| InChIKey | YJPZGPDJBYCVHC-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.13 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|