C15H14Cl2N4O3 — CID 8990848
N-[2-[[2-(2,4-dichlorophenoxy)acetyl]amino]ethyl]pyrazine-2-carboxamide (PubChem CID 8990848) has the molecular formula C15H14Cl2N4O3 and a molecular weight of 369.21 g/mol. Its IUPAC name is N-[2-[[2-(2,4-dichlorophenoxy)acetyl]amino]ethyl]pyrazine-2-carboxamide.
| Compound Name | N-[2-[[2-(2,4-dichlorophenoxy)acetyl]amino]ethyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 8990848 |
| Molecular Formula | C15H14Cl2N4O3 |
| Molecular Weight | 369.21 g/mol |
| Exact Mass | 368.04 |
| IUPAC Name | N-[2-[[2-(2,4-dichlorophenoxy)acetyl]amino]ethyl]pyrazine-2-carboxamide |
| SMILES | O=C(COc1ccc(Cl)cc1Cl)NCCNC(=O)c1cnccn1 |
| InChI | InChI=1S/C15H14Cl2N4O3/c16-10-1-2-13(11(17)7-10)24-9-14(22)20-5-6-21-15(23)12-8-18-3-4-19-12/h1-4,7-8H,5-6,9H2,(H,20,22)(H,21,23) |
| InChIKey | BMVQZLBCHTWJGL-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.21 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|