C16H16Cl2N4O3 — CID 6498608
N-[3-[[2-(2,4-dichlorophenoxy)acetyl]amino]propyl]pyrazine-2-carboxamide (PubChem CID 6498608) has the molecular formula C16H16Cl2N4O3 and a molecular weight of 383.24 g/mol. Its IUPAC name is N-[3-[[2-(2,4-dichlorophenoxy)acetyl]amino]propyl]pyrazine-2-carboxamide.
| Compound Name | N-[3-[[2-(2,4-dichlorophenoxy)acetyl]amino]propyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 6498608 |
| Molecular Formula | C16H16Cl2N4O3 |
| Molecular Weight | 383.24 g/mol |
| Exact Mass | 382.06 |
| IUPAC Name | N-[3-[[2-(2,4-dichlorophenoxy)acetyl]amino]propyl]pyrazine-2-carboxamide |
| SMILES | O=C(COc1ccc(Cl)cc1Cl)NCCCNC(=O)c1cnccn1 |
| InChI | InChI=1S/C16H16Cl2N4O3/c17-11-2-3-14(12(18)8-11)25-10-15(23)21-4-1-5-22-16(24)13-9-19-6-7-20-13/h2-3,6-9H,1,4-5,10H2,(H,21,23)(H,22,24) |
| InChIKey | BWJLCOSZRPWDQW-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.24 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|