C13H12Cl2N2O2S — CID 110717511
2-(2,4-dichlorophenoxy)-N-[2-(1,3-thiazol-5-yl)ethyl]acetamide (PubChem CID 110717511) has the molecular formula C13H12Cl2N2O2S and a molecular weight of 331.22 g/mol. Its IUPAC name is 2-(2,4-dichlorophenoxy)-N-[2-(1,3-thiazol-5-yl)ethyl]acetamide.
| Compound Name | 2-(2,4-dichlorophenoxy)-N-[2-(1,3-thiazol-5-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 110717511 |
| Molecular Formula | C13H12Cl2N2O2S |
| Molecular Weight | 331.22 g/mol |
| Exact Mass | 330.00 |
| IUPAC Name | 2-(2,4-dichlorophenoxy)-N-[2-(1,3-thiazol-5-yl)ethyl]acetamide |
| SMILES | O=C(COc1ccc(Cl)cc1Cl)NCCc1cncs1 |
| InChI | InChI=1S/C13H12Cl2N2O2S/c14-9-1-2-12(11(15)5-9)19-7-13(18)17-4-3-10-6-16-8-20-10/h1-2,5-6,8H,3-4,7H2,(H,17,18) |
| InChIKey | BNMWMHUNJGACTQ-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.22 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |