C22H19Cl2N3O5 — CID 121062756
N-[2-[[4-[[2-(2,4-dichlorophenoxy)acetyl]amino]benzoyl]amino]ethyl]furan-2-carboxamide (PubChem CID 121062756) has the molecular formula C22H19Cl2N3O5 and a molecular weight of 476.32 g/mol. Its IUPAC name is N-[2-[[4-[[2-(2,4-dichlorophenoxy)acetyl]amino]benzoyl]amino]ethyl]furan-2-carboxamide.
| Compound Name | N-[2-[[4-[[2-(2,4-dichlorophenoxy)acetyl]amino]benzoyl]amino]ethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 121062756 |
| Molecular Formula | C22H19Cl2N3O5 |
| Molecular Weight | 476.32 g/mol |
| Exact Mass | 475.07 |
| IUPAC Name | N-[2-[[4-[[2-(2,4-dichlorophenoxy)acetyl]amino]benzoyl]amino]ethyl]furan-2-carboxamide |
| SMILES | O=C(COc1ccc(Cl)cc1Cl)Nc1ccc(C(=O)NCCNC(=O)c2ccco2)cc1 |
| InChI | InChI=1S/C22H19Cl2N3O5/c23-15-5-8-18(17(24)12-15)32-13-20(28)27-16-6-3-14(4-7-16)21(29)25-9-10-26-22(30)19-2-1-11-31-19/h1-8,11-12H,9-10,13H2,(H,25,29)(H,26,30)(H,27,28) |
| InChIKey | YERRHCCYRMQPPA-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 109.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.32 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|