C25H27N3O6 — CID 121062797
N-[2-[[4-[(3,4-diethoxybenzoyl)amino]benzoyl]amino]ethyl]furan-2-carboxamide (PubChem CID 121062797) has the molecular formula C25H27N3O6 and a molecular weight of 465.51 g/mol. Its IUPAC name is N-[2-[[4-[(3,4-diethoxybenzoyl)amino]benzoyl]amino]ethyl]furan-2-carboxamide.
| Compound Name | N-[2-[[4-[(3,4-diethoxybenzoyl)amino]benzoyl]amino]ethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 121062797 |
| Molecular Formula | C25H27N3O6 |
| Molecular Weight | 465.51 g/mol |
| Exact Mass | 465.19 |
| IUPAC Name | N-[2-[[4-[(3,4-diethoxybenzoyl)amino]benzoyl]amino]ethyl]furan-2-carboxamide |
| SMILES | CCOc1ccc(C(=O)Nc2ccc(C(=O)NCCNC(=O)c3ccco3)cc2)cc1OCC |
| InChI | InChI=1S/C25H27N3O6/c1-3-32-20-12-9-18(16-22(20)33-4-2)24(30)28-19-10-7-17(8-11-19)23(29)26-13-14-27-25(31)21-6-5-15-34-21/h5-12,15-16H,3-4,13-14H2,1-2H3,(H,26,29)(H,27,31)(H,28,30) |
| InChIKey | INFYWZDWWSEACC-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 118.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.51 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|