C18H21N3O6 — CID 8901422
N-[3-[2-(4-ethoxy-3-methoxybenzoyl)hydrazinyl]-3-oxopropyl]furan-2-carboxamide (PubChem CID 8901422) has the molecular formula C18H21N3O6 and a molecular weight of 375.38 g/mol. Its IUPAC name is N-[3-[2-(4-ethoxy-3-methoxybenzoyl)hydrazinyl]-3-oxopropyl]furan-2-carboxamide.
| Compound Name | N-[3-[2-(4-ethoxy-3-methoxybenzoyl)hydrazinyl]-3-oxopropyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 8901422 |
| Molecular Formula | C18H21N3O6 |
| Molecular Weight | 375.38 g/mol |
| Exact Mass | 375.14 |
| IUPAC Name | N-[3-[2-(4-ethoxy-3-methoxybenzoyl)hydrazinyl]-3-oxopropyl]furan-2-carboxamide |
| SMILES | CCOc1ccc(C(=O)NNC(=O)CCNC(=O)c2ccco2)cc1OC |
| InChI | InChI=1S/C18H21N3O6/c1-3-26-13-7-6-12(11-15(13)25-2)17(23)21-20-16(22)8-9-19-18(24)14-5-4-10-27-14/h4-7,10-11H,3,8-9H2,1-2H3,(H,19,24)(H,20,22)(H,21,23) |
| InChIKey | CNPHZNQTNHCICJ-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 118.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.38 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|