C19H23N3O4 — CID 9477234
4-tert-butyl-N-[3-[2-(furan-2-carbonyl)hydrazinyl]-3-oxopropyl]benzamide (PubChem CID 9477234) has the molecular formula C19H23N3O4 and a molecular weight of 357.41 g/mol. Its IUPAC name is 4-tert-butyl-N-[3-[2-(furan-2-carbonyl)hydrazinyl]-3-oxopropyl]benzamide.
| Compound Name | 4-tert-butyl-N-[3-[2-(furan-2-carbonyl)hydrazinyl]-3-oxopropyl]benzamide |
|---|---|
| PubChem CID | 9477234 |
| Molecular Formula | C19H23N3O4 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.17 |
| IUPAC Name | 4-tert-butyl-N-[3-[2-(furan-2-carbonyl)hydrazinyl]-3-oxopropyl]benzamide |
| SMILES | CC(C)(C)c1ccc(C(=O)NCCC(=O)NNC(=O)c2ccco2)cc1 |
| InChI | InChI=1S/C19H23N3O4/c1-19(2,3)14-8-6-13(7-9-14)17(24)20-11-10-16(23)21-22-18(25)15-5-4-12-26-15/h4-9,12H,10-11H2,1-3H3,(H,20,24)(H,21,23)(H,22,25) |
| InChIKey | ZQEKBHJIQBZOEE-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 100.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|