C21H27N3O4 — CID 4787903
4-tert-butyl-N-[3-[2-(2,5-dimethylfuran-3-carbonyl)hydrazinyl]-3-oxopropyl]benzamide (PubChem CID 4787903) has the molecular formula C21H27N3O4 and a molecular weight of 385.46 g/mol. Its IUPAC name is 4-tert-butyl-N-[3-[2-(2,5-dimethylfuran-3-carbonyl)hydrazinyl]-3-oxopropyl]benzamide.
| Compound Name | 4-tert-butyl-N-[3-[2-(2,5-dimethylfuran-3-carbonyl)hydrazinyl]-3-oxopropyl]benzamide |
|---|---|
| PubChem CID | 4787903 |
| Molecular Formula | C21H27N3O4 |
| Molecular Weight | 385.46 g/mol |
| Exact Mass | 385.20 |
| IUPAC Name | 4-tert-butyl-N-[3-[2-(2,5-dimethylfuran-3-carbonyl)hydrazinyl]-3-oxopropyl]benzamide |
| SMILES | Cc1cc(C(=O)NNC(=O)CCNC(=O)c2ccc(C(C)(C)C)cc2)c(C)o1 |
| InChI | InChI=1S/C21H27N3O4/c1-13-12-17(14(2)28-13)20(27)24-23-18(25)10-11-22-19(26)15-6-8-16(9-7-15)21(3,4)5/h6-9,12H,10-11H2,1-5H3,(H,22,26)(H,23,25)(H,24,27) |
| InChIKey | FBNRPVOHDULKGM-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 100.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.46 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|