C17H22N2O4S — CID 26980804
N'-(4-tert-butylphenyl)sulfonyl-2,5-dimethylfuran-3-carbohydrazide (PubChem CID 26980804) has the molecular formula C17H22N2O4S and a molecular weight of 350.44 g/mol. Its IUPAC name is N'-(4-tert-butylphenyl)sulfonyl-2,5-dimethylfuran-3-carbohydrazide.
| Compound Name | N'-(4-tert-butylphenyl)sulfonyl-2,5-dimethylfuran-3-carbohydrazide |
|---|---|
| PubChem CID | 26980804 |
| Molecular Formula | C17H22N2O4S |
| Molecular Weight | 350.44 g/mol |
| Exact Mass | 350.13 |
| IUPAC Name | N'-(4-tert-butylphenyl)sulfonyl-2,5-dimethylfuran-3-carbohydrazide |
| SMILES | Cc1cc(C(=O)NNS(=O)(=O)c2ccc(C(C)(C)C)cc2)c(C)o1 |
| InChI | InChI=1S/C17H22N2O4S/c1-11-10-15(12(2)23-11)16(20)18-19-24(21,22)14-8-6-13(7-9-14)17(3,4)5/h6-10,19H,1-5H3,(H,18,20) |
| InChIKey | IACNGDZONAIRER-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 88.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.44 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|