C15H17N3O6S — CID 26487286
N'-(2,3-dimethyl-5-nitrophenyl)sulfonyl-2,5-dimethylfuran-3-carbohydrazide (PubChem CID 26487286) has the molecular formula C15H17N3O6S and a molecular weight of 367.38 g/mol. Its IUPAC name is N'-(2,3-dimethyl-5-nitrophenyl)sulfonyl-2,5-dimethylfuran-3-carbohydrazide.
| Compound Name | N'-(2,3-dimethyl-5-nitrophenyl)sulfonyl-2,5-dimethylfuran-3-carbohydrazide |
|---|---|
| PubChem CID | 26487286 |
| Molecular Formula | C15H17N3O6S |
| Molecular Weight | 367.38 g/mol |
| Exact Mass | 367.08 |
| IUPAC Name | N'-(2,3-dimethyl-5-nitrophenyl)sulfonyl-2,5-dimethylfuran-3-carbohydrazide |
| SMILES | Cc1cc(C(=O)NNS(=O)(=O)c2cc([N+](=O)[O-])cc(C)c2C)c(C)o1 |
| InChI | InChI=1S/C15H17N3O6S/c1-8-5-12(18(20)21)7-14(10(8)3)25(22,23)17-16-15(19)13-6-9(2)24-11(13)4/h5-7,17H,1-4H3,(H,16,19) |
| InChIKey | QFRIBJFGGYEMSM-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 131.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.38 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|