C12H18N2O4S — CID 17410019
N-tert-butyl-2,3-dimethyl-5-nitrobenzenesulfonamide (PubChem CID 17410019) has the molecular formula C12H18N2O4S and a molecular weight of 286.35 g/mol. Its IUPAC name is N-tert-butyl-2,3-dimethyl-5-nitrobenzenesulfonamide.
| Compound Name | N-tert-butyl-2,3-dimethyl-5-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 17410019 |
| Molecular Formula | C12H18N2O4S |
| Molecular Weight | 286.35 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | N-tert-butyl-2,3-dimethyl-5-nitrobenzenesulfonamide |
| SMILES | Cc1cc([N+](=O)[O-])cc(S(=O)(=O)NC(C)(C)C)c1C |
| InChI | InChI=1S/C12H18N2O4S/c1-8-6-10(14(15)16)7-11(9(8)2)19(17,18)13-12(3,4)5/h6-7,13H,1-5H3 |
| InChIKey | VLGCYPFFJNFNEL-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 89.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.35 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|