C12H18N2O5S — CID 45351483
N-(1-methoxypropan-2-yl)-2,3-dimethyl-5-nitrobenzenesulfonamide (PubChem CID 45351483) has the molecular formula C12H18N2O5S and a molecular weight of 302.35 g/mol. Its IUPAC name is N-(1-methoxypropan-2-yl)-2,3-dimethyl-5-nitrobenzenesulfonamide.
| Compound Name | N-(1-methoxypropan-2-yl)-2,3-dimethyl-5-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 45351483 |
| Molecular Formula | C12H18N2O5S |
| Molecular Weight | 302.35 g/mol |
| Exact Mass | 302.09 |
| IUPAC Name | N-(1-methoxypropan-2-yl)-2,3-dimethyl-5-nitrobenzenesulfonamide |
| SMILES | COCC(C)NS(=O)(=O)c1cc([N+](=O)[O-])cc(C)c1C |
| InChI | InChI=1S/C12H18N2O5S/c1-8-5-11(14(15)16)6-12(10(8)3)20(17,18)13-9(2)7-19-4/h5-6,9,13H,7H2,1-4H3 |
| InChIKey | JXGNMBJRCKJOJR-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.35 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|