C11H15ClN2O5S — CID 8777981
3-chloro-N-[(2R)-1-methoxypropan-2-yl]-4-methyl-5-nitrobenzenesulfonamide (PubChem CID 8777981) has the molecular formula C11H15ClN2O5S and a molecular weight of 322.77 g/mol. Its IUPAC name is 3-chloro-N-[(2R)-1-methoxypropan-2-yl]-4-methyl-5-nitrobenzenesulfonamide.
| Compound Name | 3-chloro-N-[(2R)-1-methoxypropan-2-yl]-4-methyl-5-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 8777981 |
| Molecular Formula | C11H15ClN2O5S |
| Molecular Weight | 322.77 g/mol |
| Exact Mass | 322.04 |
| IUPAC Name | 3-chloro-N-[(2R)-1-methoxypropan-2-yl]-4-methyl-5-nitrobenzenesulfonamide |
| SMILES | COC[C@@H](C)NS(=O)(=O)c1cc(Cl)c(C)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C11H15ClN2O5S/c1-7(6-19-3)13-20(17,18)9-4-10(12)8(2)11(5-9)14(15)16/h4-5,7,13H,6H2,1-3H3/t7-/m1/s1 |
| InChIKey | OKFPYSZCQOIHSC-SSDOTTSWSA-N |
| XLogP | 1.87 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.77 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|