C16H18N2O5S2 — CID 9279167
N-[(2S)-1-methoxypropan-2-yl]-3-nitro-4-phenylsulfanylbenzenesulfonamide (PubChem CID 9279167) has the molecular formula C16H18N2O5S2 and a molecular weight of 382.46 g/mol. Its IUPAC name is N-[(2S)-1-methoxypropan-2-yl]-3-nitro-4-phenylsulfanylbenzenesulfonamide.
| Compound Name | N-[(2S)-1-methoxypropan-2-yl]-3-nitro-4-phenylsulfanylbenzenesulfonamide |
|---|---|
| PubChem CID | 9279167 |
| Molecular Formula | C16H18N2O5S2 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.07 |
| IUPAC Name | N-[(2S)-1-methoxypropan-2-yl]-3-nitro-4-phenylsulfanylbenzenesulfonamide |
| SMILES | COC[C@H](C)NS(=O)(=O)c1ccc(Sc2ccccc2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H18N2O5S2/c1-12(11-23-2)17-25(21,22)14-8-9-16(15(10-14)18(19)20)24-13-6-4-3-5-7-13/h3-10,12,17H,11H2,1-2H3/t12-/m0/s1 |
| InChIKey | SSYINHUHGAEOQL-LBPRGKRZSA-N |
| XLogP | 3.06 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|