C15H23N3O5S — CID 9186041
N-[(2R)-1-methoxypropan-2-yl]-3-nitro-4-piperidin-1-ylbenzenesulfonamide (PubChem CID 9186041) has the molecular formula C15H23N3O5S and a molecular weight of 357.43 g/mol. Its IUPAC name is N-[(2R)-1-methoxypropan-2-yl]-3-nitro-4-piperidin-1-ylbenzenesulfonamide.
| Compound Name | N-[(2R)-1-methoxypropan-2-yl]-3-nitro-4-piperidin-1-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 9186041 |
| Molecular Formula | C15H23N3O5S |
| Molecular Weight | 357.43 g/mol |
| Exact Mass | 357.14 |
| IUPAC Name | N-[(2R)-1-methoxypropan-2-yl]-3-nitro-4-piperidin-1-ylbenzenesulfonamide |
| SMILES | COC[C@@H](C)NS(=O)(=O)c1ccc(N2CCCCC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H23N3O5S/c1-12(11-23-2)16-24(21,22)13-6-7-14(15(10-13)18(19)20)17-8-4-3-5-9-17/h6-7,10,12,16H,3-5,8-9,11H2,1-2H3/t12-/m1/s1 |
| InChIKey | UILWARLFULTNMK-GFCCVEGCSA-N |
| XLogP | 1.90 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.43 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|