C21H27ClN4O5S — CID 26451919
4-[4-(5-chloro-2-methylphenyl)piperazin-1-yl]-N-[(2R)-1-methoxypropan-2-yl]-3-nitrobenzenesulfonamide (PubChem CID 26451919) has the molecular formula C21H27ClN4O5S and a molecular weight of 482.99 g/mol. Its IUPAC name is 4-[4-(5-chloro-2-methylphenyl)piperazin-1-yl]-N-[(2R)-1-methoxypropan-2-yl]-3-nitrobenzenesulfonamide.
| Compound Name | 4-[4-(5-chloro-2-methylphenyl)piperazin-1-yl]-N-[(2R)-1-methoxypropan-2-yl]-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 26451919 |
| Molecular Formula | C21H27ClN4O5S |
| Molecular Weight | 482.99 g/mol |
| Exact Mass | 482.14 |
| IUPAC Name | 4-[4-(5-chloro-2-methylphenyl)piperazin-1-yl]-N-[(2R)-1-methoxypropan-2-yl]-3-nitrobenzenesulfonamide |
| SMILES | COC[C@@H](C)NS(=O)(=O)c1ccc(N2CCN(c3cc(Cl)ccc3C)CC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C21H27ClN4O5S/c1-15-4-5-17(22)12-20(15)25-10-8-24(9-11-25)19-7-6-18(13-21(19)26(27)28)32(29,30)23-16(2)14-31-3/h4-7,12-13,16,23H,8-11,14H2,1-3H3/t16-/m1/s1 |
| InChIKey | VVQGINLWWBENBJ-MRXNPFEDSA-N |
| XLogP | 3.20 |
| TPSA | 105.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.99 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|