C16H17ClN2O5S2 — CID 9213087
4-(4-chlorophenyl)sulfanyl-N-[(2R)-1-methoxypropan-2-yl]-3-nitrobenzenesulfonamide (PubChem CID 9213087) has the molecular formula C16H17ClN2O5S2 and a molecular weight of 416.91 g/mol. Its IUPAC name is 4-(4-chlorophenyl)sulfanyl-N-[(2R)-1-methoxypropan-2-yl]-3-nitrobenzenesulfonamide.
| Compound Name | 4-(4-chlorophenyl)sulfanyl-N-[(2R)-1-methoxypropan-2-yl]-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 9213087 |
| Molecular Formula | C16H17ClN2O5S2 |
| Molecular Weight | 416.91 g/mol |
| Exact Mass | 416.03 |
| IUPAC Name | 4-(4-chlorophenyl)sulfanyl-N-[(2R)-1-methoxypropan-2-yl]-3-nitrobenzenesulfonamide |
| SMILES | COC[C@@H](C)NS(=O)(=O)c1ccc(Sc2ccc(Cl)cc2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H17ClN2O5S2/c1-11(10-24-2)18-26(22,23)14-7-8-16(15(9-14)19(20)21)25-13-5-3-12(17)4-6-13/h3-9,11,18H,10H2,1-2H3/t11-/m1/s1 |
| InChIKey | AJQGQHWLEVQVTC-LLVKDONJSA-N |
| XLogP | 3.71 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.91 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|