C11H18N4O5S — CID 64605293
4-hydrazinyl-N-(4-methoxybutan-2-yl)-3-nitrobenzenesulfonamide (PubChem CID 64605293) has the molecular formula C11H18N4O5S and a molecular weight of 318.36 g/mol. Its IUPAC name is 4-hydrazinyl-N-(4-methoxybutan-2-yl)-3-nitrobenzenesulfonamide.
| Compound Name | 4-hydrazinyl-N-(4-methoxybutan-2-yl)-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 64605293 |
| Molecular Formula | C11H18N4O5S |
| Molecular Weight | 318.36 g/mol |
| Exact Mass | 318.10 |
| IUPAC Name | 4-hydrazinyl-N-(4-methoxybutan-2-yl)-3-nitrobenzenesulfonamide |
| SMILES | COCCC(C)NS(=O)(=O)c1ccc(NN)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C11H18N4O5S/c1-8(5-6-20-2)14-21(18,19)9-3-4-10(13-12)11(7-9)15(16)17/h3-4,7-8,13-14H,5-6,12H2,1-2H3 |
| InChIKey | HZYIRJYAOFEYDF-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 136.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.36 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|