C10H16N4O5S — CID 82854516
3-hydrazinyl-N-(1-methoxypropan-2-yl)-4-nitrobenzenesulfonamide (PubChem CID 82854516) has the molecular formula C10H16N4O5S and a molecular weight of 304.33 g/mol. Its IUPAC name is 3-hydrazinyl-N-(1-methoxypropan-2-yl)-4-nitrobenzenesulfonamide.
| Compound Name | 3-hydrazinyl-N-(1-methoxypropan-2-yl)-4-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 82854516 |
| Molecular Formula | C10H16N4O5S |
| Molecular Weight | 304.33 g/mol |
| Exact Mass | 304.08 |
| IUPAC Name | 3-hydrazinyl-N-(1-methoxypropan-2-yl)-4-nitrobenzenesulfonamide |
| SMILES | COCC(C)NS(=O)(=O)c1ccc([N+](=O)[O-])c(NN)c1 |
| InChI | InChI=1S/C10H16N4O5S/c1-7(6-19-2)13-20(17,18)8-3-4-10(14(15)16)9(5-8)12-11/h3-5,7,12-13H,6,11H2,1-2H3 |
| InChIKey | LSIRRFQQPNFUSD-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 136.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.33 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|