C17H19Cl2N3O5S — CID 41100734
4-[(2,4-dichlorophenyl)methylamino]-N-[(2R)-1-methoxypropan-2-yl]-3-nitrobenzenesulfonamide (PubChem CID 41100734) has the molecular formula C17H19Cl2N3O5S and a molecular weight of 448.33 g/mol. Its IUPAC name is 4-[(2,4-dichlorophenyl)methylamino]-N-[(2R)-1-methoxypropan-2-yl]-3-nitrobenzenesulfonamide.
| Compound Name | 4-[(2,4-dichlorophenyl)methylamino]-N-[(2R)-1-methoxypropan-2-yl]-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 41100734 |
| Molecular Formula | C17H19Cl2N3O5S |
| Molecular Weight | 448.33 g/mol |
| Exact Mass | 447.04 |
| IUPAC Name | 4-[(2,4-dichlorophenyl)methylamino]-N-[(2R)-1-methoxypropan-2-yl]-3-nitrobenzenesulfonamide |
| SMILES | COC[C@@H](C)NS(=O)(=O)c1ccc(NCc2ccc(Cl)cc2Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H19Cl2N3O5S/c1-11(10-27-2)21-28(25,26)14-5-6-16(17(8-14)22(23)24)20-9-12-3-4-13(18)7-15(12)19/h3-8,11,20-21H,9-10H2,1-2H3/t11-/m1/s1 |
| InChIKey | BFMTYRDQNWAKNQ-LLVKDONJSA-N |
| XLogP | 3.83 |
| TPSA | 110.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.33 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|