C13H9Cl3N2O2 — CID 43218114
4-chloro-N-[(2,4-dichlorophenyl)methyl]-2-nitroaniline (PubChem CID 43218114) has the molecular formula C13H9Cl3N2O2 and a molecular weight of 331.59 g/mol. Its IUPAC name is 4-chloro-N-[(2,4-dichlorophenyl)methyl]-2-nitroaniline.
| Compound Name | 4-chloro-N-[(2,4-dichlorophenyl)methyl]-2-nitroaniline |
|---|---|
| PubChem CID | 43218114 |
| Molecular Formula | C13H9Cl3N2O2 |
| Molecular Weight | 331.59 g/mol |
| Exact Mass | 329.97 |
| IUPAC Name | 4-chloro-N-[(2,4-dichlorophenyl)methyl]-2-nitroaniline |
| SMILES | O=[N+]([O-])c1cc(Cl)ccc1NCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C13H9Cl3N2O2/c14-9-2-1-8(11(16)5-9)7-17-12-4-3-10(15)6-13(12)18(19)20/h1-6,17H,7H2 |
| InChIKey | GDWWFXDVRQASNU-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 55.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.59 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|