C14H11BrCl2N2O2 — CID 29033812
4-bromo-N-[2-(2,4-dichlorophenyl)ethyl]-2-nitroaniline (PubChem CID 29033812) has the molecular formula C14H11BrCl2N2O2 and a molecular weight of 390.06 g/mol. Its IUPAC name is 4-bromo-N-[2-(2,4-dichlorophenyl)ethyl]-2-nitroaniline.
| Compound Name | 4-bromo-N-[2-(2,4-dichlorophenyl)ethyl]-2-nitroaniline |
|---|---|
| PubChem CID | 29033812 |
| Molecular Formula | C14H11BrCl2N2O2 |
| Molecular Weight | 390.06 g/mol |
| Exact Mass | 387.94 |
| IUPAC Name | 4-bromo-N-[2-(2,4-dichlorophenyl)ethyl]-2-nitroaniline |
| SMILES | O=[N+]([O-])c1cc(Br)ccc1NCCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C14H11BrCl2N2O2/c15-10-2-4-13(14(7-10)19(20)21)18-6-5-9-1-3-11(16)8-12(9)17/h1-4,7-8,18H,5-6H2 |
| InChIKey | WVXVEABQMRTBDY-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 55.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.06 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|