C12H12Cl2N4O2 — CID 103079659
N-[2-(2,4-dichlorophenyl)ethyl]-1-methyl-4-nitropyrazol-3-amine (PubChem CID 103079659) has the molecular formula C12H12Cl2N4O2 and a molecular weight of 315.16 g/mol. Its IUPAC name is N-[2-(2,4-dichlorophenyl)ethyl]-1-methyl-4-nitropyrazol-3-amine.
| Compound Name | N-[2-(2,4-dichlorophenyl)ethyl]-1-methyl-4-nitropyrazol-3-amine |
|---|---|
| PubChem CID | 103079659 |
| Molecular Formula | C12H12Cl2N4O2 |
| Molecular Weight | 315.16 g/mol |
| Exact Mass | 314.03 |
| IUPAC Name | N-[2-(2,4-dichlorophenyl)ethyl]-1-methyl-4-nitropyrazol-3-amine |
| SMILES | Cn1cc([N+](=O)[O-])c(NCCc2ccc(Cl)cc2Cl)n1 |
| InChI | InChI=1S/C12H12Cl2N4O2/c1-17-7-11(18(19)20)12(16-17)15-5-4-8-2-3-9(13)6-10(8)14/h2-3,6-7H,4-5H2,1H3,(H,15,16) |
| InChIKey | KDRRZGVCNUMTOM-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 72.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.16 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|