C9H17N5O2 — CID 103080213
N-ethyl-N'-(1-methyl-4-nitropyrazol-3-yl)propane-1,3-diamine (PubChem CID 103080213) has the molecular formula C9H17N5O2 and a molecular weight of 227.27 g/mol. Its IUPAC name is N-ethyl-N'-(1-methyl-4-nitropyrazol-3-yl)propane-1,3-diamine.
| Compound Name | N-ethyl-N'-(1-methyl-4-nitropyrazol-3-yl)propane-1,3-diamine |
|---|---|
| PubChem CID | 103080213 |
| Molecular Formula | C9H17N5O2 |
| Molecular Weight | 227.27 g/mol |
| Exact Mass | 227.14 |
| IUPAC Name | N-ethyl-N'-(1-methyl-4-nitropyrazol-3-yl)propane-1,3-diamine |
| SMILES | CCNCCCNc1nn(C)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C9H17N5O2/c1-3-10-5-4-6-11-9-8(14(15)16)7-13(2)12-9/h7,10H,3-6H2,1-2H3,(H,11,12) |
| InChIKey | PKCKJVAQVMCFCZ-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 85.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.27 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|