C8H14N4O4 — CID 107390111
N-(2,2-dimethoxyethyl)-1-methyl-4-nitropyrazol-3-amine (PubChem CID 107390111) has the molecular formula C8H14N4O4 and a molecular weight of 230.22 g/mol. Its IUPAC name is N-(2,2-dimethoxyethyl)-1-methyl-4-nitropyrazol-3-amine.
| Compound Name | N-(2,2-dimethoxyethyl)-1-methyl-4-nitropyrazol-3-amine |
|---|---|
| PubChem CID | 107390111 |
| Molecular Formula | C8H14N4O4 |
| Molecular Weight | 230.22 g/mol |
| Exact Mass | 230.10 |
| IUPAC Name | N-(2,2-dimethoxyethyl)-1-methyl-4-nitropyrazol-3-amine |
| SMILES | COC(CNc1nn(C)cc1[N+](=O)[O-])OC |
| InChI | InChI=1S/C8H14N4O4/c1-11-5-6(12(13)14)8(10-11)9-4-7(15-2)16-3/h5,7H,4H2,1-3H3,(H,9,10) |
| InChIKey | CZHDOYZPFFTSDO-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 91.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.22 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|