C7H8F4N4O2 — CID 106293717
1-methyl-4-nitro-N-(2,2,3,3-tetrafluoropropyl)pyrazol-3-amine (PubChem CID 106293717) has the molecular formula C7H8F4N4O2 and a molecular weight of 256.16 g/mol. Its IUPAC name is 1-methyl-4-nitro-N-(2,2,3,3-tetrafluoropropyl)pyrazol-3-amine.
| Compound Name | 1-methyl-4-nitro-N-(2,2,3,3-tetrafluoropropyl)pyrazol-3-amine |
|---|---|
| PubChem CID | 106293717 |
| Molecular Formula | C7H8F4N4O2 |
| Molecular Weight | 256.16 g/mol |
| Exact Mass | 256.06 |
| IUPAC Name | 1-methyl-4-nitro-N-(2,2,3,3-tetrafluoropropyl)pyrazol-3-amine |
| SMILES | Cn1cc([N+](=O)[O-])c(NCC(F)(F)C(F)F)n1 |
| InChI | InChI=1S/C7H8F4N4O2/c1-14-2-4(15(16)17)5(13-14)12-3-7(10,11)6(8)9/h2,6H,3H2,1H3,(H,12,13) |
| InChIKey | UXIXNXBXAFMAAI-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 72.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.16 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|