C8H7F4N3O2 — CID 106293565
3-nitro-N-(2,2,3,3-tetrafluoropropyl)pyridin-2-amine (PubChem CID 106293565) has the molecular formula C8H7F4N3O2 and a molecular weight of 253.16 g/mol. Its IUPAC name is 3-nitro-N-(2,2,3,3-tetrafluoropropyl)pyridin-2-amine.
| Compound Name | 3-nitro-N-(2,2,3,3-tetrafluoropropyl)pyridin-2-amine |
|---|---|
| PubChem CID | 106293565 |
| Molecular Formula | C8H7F4N3O2 |
| Molecular Weight | 253.16 g/mol |
| Exact Mass | 253.05 |
| IUPAC Name | 3-nitro-N-(2,2,3,3-tetrafluoropropyl)pyridin-2-amine |
| SMILES | O=[N+]([O-])c1cccnc1NCC(F)(F)C(F)F |
| InChI | InChI=1S/C8H7F4N3O2/c9-7(10)8(11,12)4-14-6-5(15(16)17)2-1-3-13-6/h1-3,7H,4H2,(H,13,14) |
| InChIKey | UJAXEOMBIVOBOF-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 68.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.16 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|