C15H15F3N4O2 — CID 124743986
(2R)-2-N-benzyl-3,3,3-trifluoro-1-N-(3-nitro-2-pyridinyl)propane-1,2-diamine (PubChem CID 124743986) has the molecular formula C15H15F3N4O2 and a molecular weight of 340.31 g/mol. Its IUPAC name is (2R)-2-N-benzyl-3,3,3-trifluoro-1-N-(3-nitro-2-pyridinyl)propane-1,2-diamine.
| Compound Name | (2R)-2-N-benzyl-3,3,3-trifluoro-1-N-(3-nitro-2-pyridinyl)propane-1,2-diamine |
|---|---|
| PubChem CID | 124743986 |
| Molecular Formula | C15H15F3N4O2 |
| Molecular Weight | 340.31 g/mol |
| Exact Mass | 340.11 |
| IUPAC Name | (2R)-2-N-benzyl-3,3,3-trifluoro-1-N-(3-nitro-2-pyridinyl)propane-1,2-diamine |
| SMILES | O=[N+]([O-])c1cccnc1NC[C@@H](NCc1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C15H15F3N4O2/c16-15(17,18)13(20-9-11-5-2-1-3-6-11)10-21-14-12(22(23)24)7-4-8-19-14/h1-8,13,20H,9-10H2,(H,19,21)/t13-/m1/s1 |
| InChIKey | ZHCOGTDDFRIQKY-CYBMUJFWSA-N |
| XLogP | 3.12 |
| TPSA | 80.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.31 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|