C8H13N5O3 — CID 103079719
4-[(1-methyl-4-nitropyrazol-3-yl)amino]butanamide (PubChem CID 103079719) has the molecular formula C8H13N5O3 and a molecular weight of 227.22 g/mol. Its IUPAC name is 4-[(1-methyl-4-nitropyrazol-3-yl)amino]butanamide.
| Compound Name | 4-[(1-methyl-4-nitropyrazol-3-yl)amino]butanamide |
|---|---|
| PubChem CID | 103079719 |
| Molecular Formula | C8H13N5O3 |
| Molecular Weight | 227.22 g/mol |
| Exact Mass | 227.10 |
| IUPAC Name | 4-[(1-methyl-4-nitropyrazol-3-yl)amino]butanamide |
| SMILES | Cn1cc([N+](=O)[O-])c(NCCCC(N)=O)n1 |
| InChI | InChI=1S/C8H13N5O3/c1-12-5-6(13(15)16)8(11-12)10-4-2-3-7(9)14/h5H,2-4H2,1H3,(H2,9,14)(H,10,11) |
| InChIKey | UZMIOTIWHXYTHO-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 116.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.22 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|