C9H17N5O — CID 106234066
5-[(4-amino-1-methylpyrazol-3-yl)amino]pentanamide (PubChem CID 106234066) has the molecular formula C9H17N5O and a molecular weight of 211.27 g/mol. Its IUPAC name is 5-[(4-amino-1-methylpyrazol-3-yl)amino]pentanamide.
| Compound Name | 5-[(4-amino-1-methylpyrazol-3-yl)amino]pentanamide |
|---|---|
| PubChem CID | 106234066 |
| Molecular Formula | C9H17N5O |
| Molecular Weight | 211.27 g/mol |
| Exact Mass | 211.14 |
| IUPAC Name | 5-[(4-amino-1-methylpyrazol-3-yl)amino]pentanamide |
| SMILES | Cn1cc(N)c(NCCCCC(N)=O)n1 |
| InChI | InChI=1S/C9H17N5O/c1-14-6-7(10)9(13-14)12-5-3-2-4-8(11)15/h6H,2-5,10H2,1H3,(H2,11,15)(H,12,13) |
| InChIKey | JFRZSIKYWBUUDR-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 98.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.27 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|